View source for Template:Infobox drug/testcases8

{{para|type}} {{lc:VACCine/COMBO/MAB/blank}}
{{Drugbox/testcases/navbox}}

==all/check==
{{testcase table
| drug_name=all_all
}}

==blank==
{{testcase table
| drug_name=blank
| type=
| bioavailability=bioavail
| chemical_formula=chem_form
| melting_point=100
}}

==IUPAC==
{{testcase table
| drug_name=blank w/IUPACname
| type=(with IUPAC_name)
| IUPAC_name = iupac-name
| bioavailability=bioavail
| chemical_formula=chem_form
| melting_point=100

}}

==mab==
;{{purge}} mab = data10; source=data11, target=data12 (freetext) 
{{collapse top|title=mab, source}}
<pre>
 | mab = Whole antibody
 | fab = [[Fab fragment]]
 | f(ab')2 = [[F(ab')2 fragment|F(ab')<sub>2</sub> fragment]]
 | fab' = [[Fab' fragment]]
 | scfv = [[Single-chain variable fragment]]
 | discfv = Di-[[single-chain variable fragment]]
 | sdab = [[Single domain antibody]]
 | 3funct = [[Trifunctional antibody]]
 | clfab = [[Chemically linked Fab]]
 | bite = [[Bi-specific T-cell engager]]
 | ?
</pre>

;if mab= then use source=
<pre>
| label11 = [[Monoclonal antibody#Production|Source]]
|  data11 = {{#ifeq: {{{type|}}} | mab | {{#switch: {{lc:{{{source|}}}}}
 | =
 | a = [[Rat]]
 | e = [[Hamster]]
 | i = [[Primate]]
 | o = [[Mouse]]
 | u = [[Human]]
 | xi/a = [[chimeric antibody|Chimeric]] ([[rat]]/[[human]])
 | xi/e = [[chimeric antibody|Chimeric]] ([[hamster]]/[[human]])
 | xi/i = [[chimeric antibody|Chimeric]] ([[primate]]/[[human]])
 | xi/o = [[chimeric antibody|Chimeric]] ([[mouse]]/[[human]])
 | xi = [[chimeric antibody|Chimeric]]
 | zu/a = [[Humanized]] (from [[rat]])
 | zu/e = [[Humanized]] (from [[hamster]])
 | zu/i = [[Humanized]] (from [[primate]])
 | zu/o = [[Humanized]] (from [[mouse]])
 | zu = [[Humanized]]
 | xizu/a = [[chimeric antibody|Chimeric]]/[[humanized]] hybrid ([[rat]]/[[human]])
 | xizu/e = [[chimeric antibody|Chimeric]]/[[humanized]] hybrid ([[hamster]]/[[human]])
 | xizu/i = [[chimeric antibody|Chimeric]]/[[humanized]] hybrid ([[primate]]/[[human]])
 | xizu/o = [[chimeric antibody|Chimeric]]/[[humanized]] hybrid ([[mouse]]/[[human]])
 | xizu = [[chimeric antibody|Chimeric]]/[[humanized]] hybrid
 | axo = [[Rat]]/[[mouse]] hybrid
 | {{{source|}}} [[:Category:Drugboxes with unformatted antibody source]]
</pre>
{{collapse bottom}}

{{testcase table
|type=mab
<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|monograph|rifapentine}}
| MedlinePlus = a602026
| pregnancy_category =  
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability = increases when administered with food
| chemical_formula=chem_form
| melting_point=100

<!--Identifiers-->
| CAS_number = 61379-65-5

| NIAID_ChemDB = 007686

<!--Chemical data-->
| molecular_weight = 877.031 g/mol
| StdInChIKey = WDZCUPBHRAEYDL-GZAUEHORSA-N
}}

==combo==
{{testcase table
| drug_name=combo
| type=combo
| bioavailability=bioavail
| chemical_formula=chem_form
| melting_point=100
| component2=c2
| component1=c1
}}


{{testcase table
| drug_name=combo5
| type=combo
| bioavailability=bioavail
| chemical_formula=chem_form
| melting_point=100
| component2=c2
| component1=c1
| component5=c5
|component4=c4
|component3=c3
|class1=cl1
|class2=c2
|class3=
|class4=cl4
|class5=cl5
}}

==vaccine==
{{para|vaccin_type}}
<pre>
 |killed |inactivated = Killed/Inactivated
 |attenuated = [[Attenuated virus]]
 |live = Live bacteria
 |toxoid = [[Toxoid]]
 |subunit = Subunit
 |protein subunit |protein = [[Protein subunit]]
 |conjugate=[[Conjugate vaccine]]
 |recombinant = [[Recombinant DNA|Recombinant Vector]]
 |dna = [[DNA vaccination]]
 | ?
</pre>
{{testcase table
| drug_name=vaccine w/target
| type=vaccine
|target = _target_
|vaccine_type=attenuated
<!--| bioavailability=bioavail-->
| chemical_formula=chem_form
| melting_point=100
<!--Pharmacokinetic data-->
| bioavailability = increases when administered with food
<!--Identifiers-->
| CAS_number = 61379-65-5
}}

{{testcase table
| drug_name=vaccine, no target
| type=vaccine
| target=
| vaccine_type=attenuated
<!--| bioavailability=bioavail-->
| chemical_formula=chem_form
| melting_point=100
<!--Pharmacokinetic data-->
| bioavailability = increases when administered with food
<!--Identifiers-->
| CAS_number = 61379-65-5
}}
==TITLE tests (drug_name, INN)==

== Licence ==
{{purge}}
{{testcase table
| name = {{PAGENAME}}
| INN = [[Linezolid]]
| Verifiedfields = changed
| verifiedrevid = 415028406
| IUPAC_name = (''S'')-''N''-({3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide
| image = Linezolid.svg
| alt = Skeletal formula of linezolid
| image2 = Linezolid-from-xtal-2008-3D-balls.png

<!--Clinical data-->
| pronounce   = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}
| tradename = Linospan, Zyvox, Zyvoxam, Zyvoxid
| Drugs.com = {{drugs.com|monograph|linezolid}}
| MedlinePlus = a602004
| licence_CA = Linezolid
| licence_EU = Linezolid
| DailyMedID = Linezolid
| licence_US = Linezolid
| pregnancy_US = C
| pregnancy_AU = C
| legal_status_AU = S4
| legal_status_UK = POM
| legal_status_US = ℞-only
| routes_of_administration = [[Intravenous therapy|Intravenous infusion]], oral
| dependency_liability = High
| addiction_liability = Low
<!--Pharmacokinetic data-->
| metabolites       = some stuff
| duration_of_action= 1 to 3 hr
| bioavailability = ~100% (oral)
| protein_bound = Low (31%)
| metabolism = [[Liver|Hepatic]] (50–70%, [[cytochrome P450|CYP]] not&nbsp;involved)
| elimination_half-life = 4.2–5.4 hours (shorter in children)
| excretion = Nonrenal, [[kidney|renal]], and fecal
| onset = 1 hr

<!--Identifiers-->
| synonyms = Lenzomore
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| ATC_prefix = J01
| ATC_suffix = XX08
| PubChem = 441401
| DrugBank_Ref = 
| DrugBank = DB00601
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 126
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
| IUPHAR_ligand = 1234

<!--Chemical data-->
| C=16 | H=20 | F=1 | N=3 | O=4 
| molecular_weight = 337.346 g/mol
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| InChI = 1/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N
<!-- phys data -->
| density = 1.40
| melting_point = 135
| boiling_point = 140
| boiling_notes = (decomposes)
| solubility = 3}}
{{purge}}

==English language variants: Licence or License==
: See also [[WP:ENGVAR]]: english language variant of the article
:In {{tlf|Infobox drug}}: spelling of '''licence/license'''. Default is to be en-US: ''License''.
: Use new parameter {{para|engvar}} for non-default spelling:
;Default {{red|licenSe}} {{nobold|1=(US)}}
{{testcase table

| drug_name=demo
| licence_US = C
| licence_UK = OTC
}}

;{{para|engvar|en-US}} {{red|licenSe}}
{{testcase table

| drug_name=demo
| engvar=en-US
| licence_CA = Linezolid
| licence_EU = Linezolid
| DailyMedID = Linezolid
| licence_US = Linezolid
}}

;{{para|engvar|en-UK}} {{red|licenCe}}
{{testcase table

| drug_name=demo
| engvar=en-UK
| licence_CA = Linezolid
| licence_EU = Linezolid
| DailyMedID = Linezolid
| licence_US = Linezolid
}}
;{{para|engvar|en-NZ}} {{red|licenCe}}
{{testcase table

| drug_name=demo
| engvar=en-NZ
| licence_CA = Linezolid
| licence_EU = Linezolid
| DailyMedID = Linezolid
| licence_US = Linezolid
}}

==Titletests==
The infobox title is a logical result of input:
* <nowiki>{{PAGENAME}}</nowiki> (default)
* {{para|drug_name}} (overwrites, eg when PAGENAME is not the INN drugname)
* {{para|INN}} (added, when PAGENAME/drug_name is not the INN name)
:See {{clc|Infobox drug articles with non-default infobox title}}

===?===
{{purge}} (reduced infobox)
:Current infobox title: {{strong|1= Diamorphine ({{abbr|INN|International Nonproprietary Name}})}}
: The new situation required an edit.
{{testcase table

| drug_name = Heroin
| INN = Diamorphine
| IUPAC_name = (5α,6α)-7,8-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate
| image = Heroin - Heroine.svg
| image2 = Heroin-from-xtal-horizontal-3D-balls.png

<!--Clinical data-->
| pronounce = {{IPAc-en|ˈ|h|ɛ|r|o:|ɪ|n}}
| Drugs.com = {{drugs.com|parent|heroin}}
| legal_AU = S9
| dependency_liability = Physical: Very high<br />Psychological: Very high
| addiction_liability = Very high
| routes_of_administration = Inhalation, transmucosal, intravenous, oral, intranasal, rectal, intramuscular

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 561-27-3
| ATC_prefix = N07
| ATC_suffix = BC06
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27808
| PubChem = 5462328
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01452
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4575379
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8H672SHT8E
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 459324
<!--Chemical data-->
| C=21 | H=23 | N=1 | O=5
| molecular_weight = 369.41&nbsp;g/mol
| synonyms = Diamorphine, Diacetylmorphine, Acetomorphine, (Dual) Acetylated morphine, Morphine diacetate
}}

===Lysergide (LSD)===
{{Purge}} Reduced infobox.
:Current infobox title: {{strong|1=Lysergic acid diethylamide}} (pagename, not INN)
:New situation would be (adding "(LSD)" is just a liberty I took, to help our readers):
{{Testcase table

| drug_name=Lysergic acid diethylamide (LSD)
| INN = Lysergide
| IUPAC_name = (6a''R'',9''R'')-''N'',''N''-diethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo-[4,3-''fg'']quinoline-9-carboxamide
| image = LSD-2D-skeletal-formula-and-3D-models.png
<!--Clinical data-->
| pregnancy_US = C
| legal_AU = Schedule 9
| legal_CA = Schedule III
| legal_NZ = Class A
| legal_UK = Class A
| legal_UN = P I
| legal_US = Schedule I
| legal_DE = Anlage I
| addiction_liability = None
| dependency_liability = Low
| routes_of_administration = [[Oral administration|Oral]], etc

<!--Pharmacokinetic data-->
| metabolism = Hepatic
| elimination_half-life = 3–5 hours
| excretion = [[Renal]]

<!--Identifiers-->
| CAS_number = 50-37-3
| ChEBI = 6605
| PubChem = 5761
| IUPHAR_ligand = 17
| DrugBank = DB04829
| ChemSpiderID = 5558
| UNII = 8NA5SWF92O
| ChEMBL = 263881
| ATC_prefix = none

<!--Chemical data-->
| C=20 | H=25 | N=3 | O=1
| synonyms = Acid, LSD, lysergide
}}

== (regular)==
* [[alpha-Methyltryptamine]]
: No need to use {{para|INN}}. Note the titletext (mousehover).
{{Testcase table

| IUPAC_name = 2-(1''H''-indol-3-yl)-1-methyl-ethylamine
| image = AMT.svg
| width = 150px
| drug_name = α-Methyltryptamine

<!--Clinical data-->
| routes_of_administration = [[Mouth|Oral]]

<!--Identifiers-->
| CAS_number = 299-26-3
| ATC_prefix = none
| ATC_suffix =

<!--Chemical data-->
| C=11 | H=14 | N=2
| synonyms = Indopan; IT-290, IT-403, U-14,164E, 3-IT
}}

==Title==
{{testcase table

| CAS_number = 1234-56-7
| trade_names=no dn
}}

{{testcase table

| drug_name =
| CAS_number = 1234-56-7
| trade_names=blank dn
}}

{{testcase table

| drug_name = Infobox drug/testcases8
| CAS_number = 1234-56-7
| trade_names = dn=pagenm
}}

{{testcase table

| drug_name = Aspirin
| CAS_number = 1234-56-7
| trade_names=dn is diff
}}

===INN===
{{testcase table

| CAS_number = 1234-56-7
| trade_names=no dn
| INN = inn
}}

{{testcase table

| drug_name =
| CAS_number = 1234-56-7
| trade_names=blank dn
| INN = inn
}}

{{testcase table

| drug_name = Infobox drug/testcases8
| CAS_number = 1234-56-7
| trade_names = dn=pagenm
| INN = inn
}}

{{testcase table

| drug_name = Aspirin [[Main page|MP]]
| CAS_number = 1234-56-7
| trade_names=dn is diff
| INN = inn
}}

==INN=none==
{{testcase table

| CAS_number = 1234-56-7
| trade_names=no dn
}}

{{testcase table

| drug_name =
| CAS_number = 1234-56-7
| trade_names=blank dn
}}

{{testcase table

| drug_name = Infobox drug/testcases8
| CAS_number = 1234-56-7
| trade_names = dn=pagenm
}}

{{testcase table

| drug_name = Aspirin
| CAS_number = 1234-56-7
| trade_names=dn is diff
}}

===INN=sense===
{{testcase table

| CAS_number = 1234-56-7
| trade_names=no dn
| INN = inn
}}

{{testcase table

| drug_name =
| CAS_number = 1234-56-7
| trade_names=blank dn
| INN = inn
}}

{{testcase table

| drug_name = Infobox drug/testcases8
| CAS_number = 1234-56-7
| trade_names = dn=pagenm
| INN = inn
}}

{{testcase table

| drug_name = Aspirin
| CAS_number = 1234-56-7
| trade_names=dn is diff
| INN = inn
}}

===INN='none'===
{{testcase table

| CAS_number = 1234-56-7
| trade_names=no dn
| INN = none
}}

{{testcase table

| drug_name =
| CAS_number = 1234-56-7
| trade_names=blank dn
| INN = none
}}

{{testcase table

| drug_name = Infobox drug/testcases8
| CAS_number = 1234-56-7
| trade_names = dn=pagenm
| INN = None
}}

{{testcase table

| drug_name = Aspirin
| CAS_number = 1234-56-7
| trade_names=dn is diff
| INN = none
}}

===INN eq===
{{testcase table

| drug_name = Infobox drug/testcases8
| INN = Infobox drug/testcases8
| CAS_number = 1234-56-7
| trade_names = dn=pagenm
}}

===all===
{{testcase table
| no_param_name=99
}}